C25H39NO4Si — CID 102520015
2-[6-ethynyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-pyridinyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 102520015) has the molecular formula C25H39NO4Si and a molecular weight of 445.68 g/mol. Its IUPAC name is 2-[6-ethynyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-pyridinyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[6-ethynyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-pyridinyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102520015 |
| Molecular Formula | C25H39NO4Si |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 2-[6-ethynyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-pyridinyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | C#Cc1cc(OCCOCCOCCOC)cc(C#C[Si](C(C)C)(C(C)C)C(C)C)n1 |
| InChI | InChI=1S/C25H39NO4Si/c1-9-23-18-25(30-16-15-29-14-13-28-12-11-27-8)19-24(26-23)10-17-31(20(2)3,21(4)5)22(6)7/h1,18-22H,11-16H2,2-8H3 |
| InChIKey | KRRACZHRPHRIMW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|