C33H42OSi — CID 101252048
2-[3-[2-(4-ethynylphenyl)ethynyl]-5-hexoxyphenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 101252048) has the molecular formula C33H42OSi and a molecular weight of 482.78 g/mol. Its IUPAC name is 2-[3-[2-(4-ethynylphenyl)ethynyl]-5-hexoxyphenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[3-[2-(4-ethynylphenyl)ethynyl]-5-hexoxyphenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101252048 |
| Molecular Formula | C33H42OSi |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 2-[3-[2-(4-ethynylphenyl)ethynyl]-5-hexoxyphenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | C#Cc1ccc(C#Cc2cc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(OCCCCCC)c2)cc1 |
| InChI | InChI=1S/C33H42OSi/c1-9-11-12-13-21-34-33-24-31(19-18-30-16-14-29(10-2)15-17-30)23-32(25-33)20-22-35(26(3)4,27(5)6)28(7)8/h2,14-17,23-28H,9,11-13,21H2,1,3-8H3 |
| InChIKey | QPBKULCWASREIE-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|