C42H60O3Si — CID 102318732
4-[2,5-dihexoxy-4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol (PubChem CID 102318732) has the molecular formula C42H60O3Si and a molecular weight of 641.03 g/mol. Its IUPAC name is 4-[2,5-dihexoxy-4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[2,5-dihexoxy-4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 102318732 |
| Molecular Formula | C42H60O3Si |
| Molecular Weight | 641.03 g/mol |
| Exact Mass | 640.43 |
| IUPAC Name | 4-[2,5-dihexoxy-4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol |
| SMILES | CCCCCCOc1cc(C#CC(C)(C)O)c(OCCCCCC)cc1C#Cc1ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C42H60O3Si/c1-11-13-15-17-28-44-40-32-39(25-27-42(9,10)43)41(45-29-18-16-14-12-2)31-38(40)24-23-36-19-21-37(22-20-36)26-30-46(33(3)4,34(5)6)35(7)8/h19-22,31-35,43H,11-18,28-29H2,1-10H3 |
| InChIKey | ZBPNPPCAAXBZTM-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.03 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|