C70H114O4Si2 — CID 15528898
2-[2-[4-[4,5-dioctoxy-2-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]-4,5-dioctoxyphenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 15528898) has the molecular formula C70H114O4Si2 and a molecular weight of 1075.85 g/mol. Its IUPAC name is 2-[2-[4-[4,5-dioctoxy-2-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]-4,5-dioctoxyphenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2-[4-[4,5-dioctoxy-2-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]-4,5-dioctoxyphenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 15528898 |
| Molecular Formula | C70H114O4Si2 |
| Molecular Weight | 1075.85 g/mol |
| Exact Mass | 1074.83 |
| IUPAC Name | 2-[2-[4-[4,5-dioctoxy-2-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]-4,5-dioctoxyphenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CCCCCCCCOc1cc(C#CC#Cc2cc(OCCCCCCCC)c(OCCCCCCCC)cc2C#C[Si](C(C)C)(C(C)C)C(C)C)c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc1OCCCCCCCC |
| InChI | InChI=1S/C70H114O4Si2/c1-17-21-25-29-33-39-47-71-67-53-63(65(45-51-75(57(5)6,58(7)8)59(9)10)55-69(67)73-49-41-35-31-27-23-19-3)43-37-38-44-64-54-68(72-48-40-34-30-26-22-18-2)70(74-50-42-36-32-28-24-20-4)56-66(64)46-52-76(60(11)12,61(13)14)62(15)16/h53-62H,17-36,39-42,47-50H2,1-16H3 |
| InChIKey | WOWKVLRQCAVTAY-UHFFFAOYSA-N |
| XLogP | 21.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.85 |
| LogP ≤ 5 | 21.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|