C22H34O2Si2 — CID 11132838
2-[2,5-dipropoxy-4-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane (PubChem CID 11132838) has the molecular formula C22H34O2Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is 2-[2,5-dipropoxy-4-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[2,5-dipropoxy-4-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11132838 |
| Molecular Formula | C22H34O2Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[2,5-dipropoxy-4-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| SMILES | CCCOc1cc(C#C[Si](C)(C)C)c(OCCC)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C22H34O2Si2/c1-9-13-23-21-17-20(12-16-26(6,7)8)22(24-14-10-2)18-19(21)11-15-25(3,4)5/h17-18H,9-10,13-14H2,1-8H3 |
| InChIKey | LDHLEQNSIGUIKI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|