C70H97NO4Si2 — CID 102443793
2-[3,6-bis[2-(2,6-dioctoxyphenyl)ethynyl]-8-(2-trimethylsilylethynyl)-9H-carbazol-1-yl]ethynyl-trimethylsilane (PubChem CID 102443793) has the molecular formula C70H97NO4Si2 and a molecular weight of 1072.72 g/mol. Its IUPAC name is 2-[3,6-bis[2-(2,6-dioctoxyphenyl)ethynyl]-8-(2-trimethylsilylethynyl)-9H-carbazol-1-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,6-bis[2-(2,6-dioctoxyphenyl)ethynyl]-8-(2-trimethylsilylethynyl)-9H-carbazol-1-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 102443793 |
| Molecular Formula | C70H97NO4Si2 |
| Molecular Weight | 1072.72 g/mol |
| Exact Mass | 1071.70 |
| IUPAC Name | 2-[3,6-bis[2-(2,6-dioctoxyphenyl)ethynyl]-8-(2-trimethylsilylethynyl)-9H-carbazol-1-yl]ethynyl-trimethylsilane |
| SMILES | CCCCCCCCOc1cccc(OCCCCCCCC)c1C#Cc1cc(C#C[Si](C)(C)C)c2[nH]c3c(C#C[Si](C)(C)C)cc(C#Cc4c(OCCCCCCCC)cccc4OCCCCCCCC)cc3c2c1 |
| InChI | InChI=1S/C70H97NO4Si2/c1-11-15-19-23-27-31-47-72-65-37-35-38-66(73-48-32-28-24-20-16-12-2)61(65)43-41-57-53-59(45-51-76(5,6)7)69-63(55-57)64-56-58(54-60(70(64)71-69)46-52-77(8,9)10)42-44-62-67(74-49-33-29-25-21-17-13-3)39-36-40-68(62)75-50-34-30-26-22-18-14-4/h35-40,53-56,71H,11-34,47-50H2,1-10H3 |
| InChIKey | CFKUUUXDWUBXLM-UHFFFAOYSA-N |
| XLogP | 19.54 |
| TPSA | 52.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.72 |
| LogP ≤ 5 | 19.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|