C15H20O5 — CID 102421816
[5-ethynyl-3-(hydroxymethyl)-2-[2-(2-methoxyethoxy)ethoxy]phenyl]methanol (PubChem CID 102421816) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [5-ethynyl-3-(hydroxymethyl)-2-[2-(2-methoxyethoxy)ethoxy]phenyl]methanol.
| Compound Name | [5-ethynyl-3-(hydroxymethyl)-2-[2-(2-methoxyethoxy)ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 102421816 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [5-ethynyl-3-(hydroxymethyl)-2-[2-(2-methoxyethoxy)ethoxy]phenyl]methanol |
| SMILES | C#Cc1cc(CO)c(OCCOCCOC)c(CO)c1 |
| InChI | InChI=1S/C15H20O5/c1-3-12-8-13(10-16)15(14(9-12)11-17)20-7-6-19-5-4-18-2/h1,8-9,16-17H,4-7,10-11H2,2H3 |
| InChIKey | WYDCSOLOIKDUKW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|