C36H36O7 — CID 158535628
2-methoxyethyl 3,5-bis[2-[3-(2,2-dimethylpropanoyloxy)phenyl]ethynyl]benzoate (PubChem CID 158535628) has the molecular formula C36H36O7 and a molecular weight of 580.68 g/mol. Its IUPAC name is 2-methoxyethyl 3,5-bis[2-[3-(2,2-dimethylpropanoyloxy)phenyl]ethynyl]benzoate.
| Compound Name | 2-methoxyethyl 3,5-bis[2-[3-(2,2-dimethylpropanoyloxy)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 158535628 |
| Molecular Formula | C36H36O7 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 2-methoxyethyl 3,5-bis[2-[3-(2,2-dimethylpropanoyloxy)phenyl]ethynyl]benzoate |
| SMILES | COCCOC(=O)c1cc(C#Cc2cccc(OC(=O)C(C)(C)C)c2)cc(C#Cc2cccc(OC(=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C36H36O7/c1-35(2,3)33(38)42-30-12-8-10-25(23-30)14-16-27-20-28(22-29(21-27)32(37)41-19-18-40-7)17-15-26-11-9-13-31(24-26)43-34(39)36(4,5)6/h8-13,20-24H,18-19H2,1-7H3 |
| InChIKey | OBUBKSSLTJJQAY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|