C30H34O6 — CID 129137282
[3-[1,1-bis[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 129137282) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is [3-[1,1-bis[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[1,1-bis[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 129137282 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [3-[1,1-bis[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | COCOc1ccc(C(=C(C)c2cccc(OC(=O)C(C)(C)C)c2)c2ccc(OCOC)cc2)cc1 |
| InChI | InChI=1S/C30H34O6/c1-21(24-8-7-9-27(18-24)36-29(31)30(2,3)4)28(22-10-14-25(15-11-22)34-19-32-5)23-12-16-26(17-13-23)35-20-33-6/h7-18H,19-20H2,1-6H3 |
| InChIKey | JBIZKIGPKIBQTR-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|