C26H26O4 — CID 129137278
[4-[1,1-bis(4-hydroxyphenyl)prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 129137278) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is [4-[1,1-bis(4-hydroxyphenyl)prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[1,1-bis(4-hydroxyphenyl)prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 129137278 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [4-[1,1-bis(4-hydroxyphenyl)prop-1-en-2-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H26O4/c1-17(18-9-15-23(16-10-18)30-25(29)26(2,3)4)24(19-5-11-21(27)12-6-19)20-7-13-22(28)14-8-20/h5-16,27-28H,1-4H3 |
| InChIKey | WRZODNAICPYXMW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|