C12H15O4P — CID 118427003
[4-(phosphorosooxymethyl)phenyl] 2,2-dimethylpropanoate (PubChem CID 118427003) has the molecular formula C12H15O4P and a molecular weight of 254.22 g/mol. Its IUPAC name is [4-(phosphorosooxymethyl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(phosphorosooxymethyl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118427003 |
| Molecular Formula | C12H15O4P |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [4-(phosphorosooxymethyl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(COP=O)cc1 |
| InChI | InChI=1S/C12H15O4P/c1-12(2,3)11(13)16-10-6-4-9(5-7-10)8-15-17-14/h4-7H,8H2,1-3H3 |
| InChIKey | IMKGZMPYUPFSTH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|