C20H22O6 — CID 17170795
2-methoxyethyl 3-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoate (PubChem CID 17170795) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-methoxyethyl 3-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoate.
| Compound Name | 2-methoxyethyl 3-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 17170795 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-methoxyethyl 3-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoate |
| SMILES | COCCOC(=O)c1cccc(OC(=O)COc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C20H22O6/c1-14-9-15(2)11-18(10-14)25-13-19(21)26-17-6-4-5-16(12-17)20(22)24-8-7-23-3/h4-6,9-12H,7-8,13H2,1-3H3 |
| InChIKey | GVMWARXYQAMZKR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|