C23H36O8 — CID 170966287
3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-methylphenyl]prop-2-yn-1-ol (PubChem CID 170966287) has the molecular formula C23H36O8 and a molecular weight of 440.53 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-methylphenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-methylphenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 170966287 |
| Molecular Formula | C23H36O8 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-methylphenyl]prop-2-yn-1-ol |
| SMILES | COCCOCCOCCOCCOCCOCCOc1cc(C)ccc1C#CCO |
| InChI | InChI=1S/C23H36O8/c1-21-5-6-22(4-3-7-24)23(20-21)31-19-18-30-17-16-29-15-14-28-13-12-27-11-10-26-9-8-25-2/h5-6,20,24H,7-19H2,1-2H3 |
| InChIKey | MWEICDUDESVXBY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|