C34H47BrNO7S+ — CID 161360313
3-[4-(3-bromopropoxy)-2-[2-[2-butoxy-4-prop-1-ynyl-5-(3-sulfopropoxy)phenyl]ethynyl]-5-methylphenoxy]propyl-trimethylazanium (PubChem CID 161360313) has the molecular formula C34H47BrNO7S+ and a molecular weight of 693.72 g/mol. Its IUPAC name is 3-[4-(3-bromopropoxy)-2-[2-[2-butoxy-4-prop-1-ynyl-5-(3-sulfopropoxy)phenyl]ethynyl]-5-methylphenoxy]propyl-trimethylazanium.
| Compound Name | 3-[4-(3-bromopropoxy)-2-[2-[2-butoxy-4-prop-1-ynyl-5-(3-sulfopropoxy)phenyl]ethynyl]-5-methylphenoxy]propyl-trimethylazanium |
|---|---|
| PubChem CID | 161360313 |
| Molecular Formula | C34H47BrNO7S+ |
| Molecular Weight | 693.72 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | 3-[4-(3-bromopropoxy)-2-[2-[2-butoxy-4-prop-1-ynyl-5-(3-sulfopropoxy)phenyl]ethynyl]-5-methylphenoxy]propyl-trimethylazanium |
| SMILES | CC#Cc1cc(OCCCC)c(C#Cc2cc(OCCCBr)c(C)cc2OCCC[N+](C)(C)C)cc1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C34H46BrNO7S/c1-7-9-18-41-34-25-28(13-8-2)33(43-21-12-22-44(37,38)39)26-30(34)15-14-29-24-31(40-19-10-16-35)27(3)23-32(29)42-20-11-17-36(4,5)6/h23-26H,7,9-12,16-22H2,1-6H3/p+1 |
| InChIKey | DYJMBJYNNWQNGW-UHFFFAOYSA-O |
| XLogP | 6.24 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|