C11H17BF4N2O2 — CID 139999947
4-(3-methylimidazol-3-ium-1-yl)butyl prop-2-enoate tetrafluoroborate (PubChem CID 139999947) has the molecular formula C11H17BF4N2O2 and a molecular weight of 296.07 g/mol. Its IUPAC name is 4-(3-methylimidazol-3-ium-1-yl)butyl prop-2-enoate tetrafluoroborate.
| Compound Name | 4-(3-methylimidazol-3-ium-1-yl)butyl prop-2-enoate tetrafluoroborate |
|---|---|
| PubChem CID | 139999947 |
| Molecular Formula | C11H17BF4N2O2 |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-(3-methylimidazol-3-ium-1-yl)butyl prop-2-enoate tetrafluoroborate |
| SMILES | C=CC(=O)OCCCCn1cc[n+](C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C11H17N2O2.BF4/c1-3-11(14)15-9-5-4-6-13-8-7-12(2)10-13;2-1(3,4)5/h3,7-8,10H,1,4-6,9H2,2H3;/q+1;-1 |
| InChIKey | YFTJHFATZXQMCY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|