C17H21BF4N2O4 — CID 11327143
2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(2-formylphenoxy)butanoate tetrafluoroborate (PubChem CID 11327143) has the molecular formula C17H21BF4N2O4 and a molecular weight of 404.17 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(2-formylphenoxy)butanoate tetrafluoroborate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(2-formylphenoxy)butanoate tetrafluoroborate |
|---|---|
| PubChem CID | 11327143 |
| Molecular Formula | C17H21BF4N2O4 |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(2-formylphenoxy)butanoate tetrafluoroborate |
| SMILES | C[n+]1ccn(CCOC(=O)CCCOc2ccccc2C=O)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C17H21N2O4.BF4/c1-18-8-9-19(14-18)10-12-23-17(21)7-4-11-22-16-6-3-2-5-15(16)13-20;2-1(3,4)5/h2-3,5-6,8-9,13-14H,4,7,10-12H2,1H3;/q+1;-1 |
| InChIKey | RCRCPXLKSIRNJX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|