C22H25N4O2S+ — CID 53259858
2-(3-methylimidazol-3-ium-1-yl)ethyl 3-phenyl-2-(phenylcarbamothioylamino)propanoate (PubChem CID 53259858) has the molecular formula C22H25N4O2S+ and a molecular weight of 409.54 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 3-phenyl-2-(phenylcarbamothioylamino)propanoate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 3-phenyl-2-(phenylcarbamothioylamino)propanoate |
|---|---|
| PubChem CID | 53259858 |
| Molecular Formula | C22H25N4O2S+ |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 3-phenyl-2-(phenylcarbamothioylamino)propanoate |
| SMILES | C[n+]1ccn(CCOC(=O)C(Cc2ccccc2)NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H24N4O2S/c1-25-12-13-26(17-25)14-15-28-21(27)20(16-18-8-4-2-5-9-18)24-22(29)23-19-10-6-3-7-11-19/h2-13,17,20H,14-16H2,1H3,(H-,23,24,29)/p+1 |
| InChIKey | FLIWQXGHUXQHII-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|