C10H18BrN5O2 — CID 167663958
2-(diaminomethylideneamino)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate bromide (PubChem CID 167663958) has the molecular formula C10H18BrN5O2 and a molecular weight of 320.19 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate bromide.
| Compound Name | 2-(diaminomethylideneamino)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate bromide |
|---|---|
| PubChem CID | 167663958 |
| Molecular Formula | C10H18BrN5O2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(diaminomethylideneamino)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate bromide |
| SMILES | C[n+]1ccn(CCC(=O)OCCN=C(N)N)c1.[Br-] |
| InChI | InChI=1S/C10H18N5O2.BrH/c1-14-5-6-15(8-14)4-2-9(16)17-7-3-13-10(11)12;/h5-6,8H,2-4,7H2,1H3,(H4,11,12,13);1H/q+1;/p-1 |
| InChIKey | XXKCAEWPVMLNDL-UHFFFAOYSA-M |
| XLogP | -4.48 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|