About 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide
2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide (PubChem CID 87366612) has the molecular formula C10H17BrN2O3
and a molecular weight of 293.16 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide |
| PubChem CID | 87366612 |
| Molecular Formula | C10H17BrN2O3 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide |
| SMILES | CCOCCOC(=O)Cn1cc[n+](C)c1.[Br-] |
| InChI | InChI=1S/C10H17N2O3.BrH/c1-3-14-6-7-15-10(13)8-12-5-4-11(2)9-12;/h4-5,9H,3,6-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PPKZCURHLLCUBI-UHFFFAOYSA-M |
| XLogP | -3.10 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
The IUPAC name of 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide (CID 87366612) is 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide.
What is the SMILES notation for 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
The canonical SMILES for 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide is CCOCCOC(=O)Cn1cc[n+](C)c1.[Br-].
What is the InChIKey of 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
The InChIKey is PPKZCURHLLCUBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H17N2O3.BrH/c1-3-14-6-7-15-10(13)8-12-5-4-11(2)9-12;/h4-5,9H,3,6-8H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide has a molecular weight of 293.16 g/mol, XLogP of -3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide is sourced from PubChem (CID 87366612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).