C17H32N2O7S — CID 87367245
2-methoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate (PubChem CID 87367245) has the molecular formula C17H32N2O7S and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-methoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate.
| Compound Name | 2-methoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate |
|---|---|
| PubChem CID | 87367245 |
| Molecular Formula | C17H32N2O7S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-methoxyethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].COCCOC(=O)Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C9H15N2O3.C8H18O4S/c1-10-3-4-11(8-10)7-9(12)14-6-5-13-2;1-2-3-4-5-6-7-8-12-13(9,10)11/h3-4,8H,5-7H2,1-2H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | OWNGSEVWZBOPQG-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 110.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|