C22H40N2O8S — CID 87076110
1-O-methyl 3-O-pentyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate (PubChem CID 87076110) has the molecular formula C22H40N2O8S and a molecular weight of 492.64 g/mol. Its IUPAC name is 1-O-methyl 3-O-pentyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate.
| Compound Name | 1-O-methyl 3-O-pentyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
|---|---|
| PubChem CID | 87076110 |
| Molecular Formula | C22H40N2O8S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 1-O-methyl 3-O-pentyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCCCOC(=O)C(C)(C(=O)OC)n1cc[n+](C)c1 |
| InChI | InChI=1S/C14H23N2O4.C8H18O4S/c1-5-6-7-10-20-13(18)14(2,12(17)19-4)16-9-8-15(3)11-16;1-2-3-4-5-6-7-8-12-13(9,10)11/h8-9,11H,5-7,10H2,1-4H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | SMYUROVJGTWIGG-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 127.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|