C23H34N2O8S — CID 87076056
3-O-benzyl 1-O-methyl (2S)-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate (PubChem CID 87076056) has the molecular formula C23H34N2O8S and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl (2S)-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate.
| Compound Name | 3-O-benzyl 1-O-methyl (2S)-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
|---|---|
| PubChem CID | 87076056 |
| Molecular Formula | C23H34N2O8S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3-O-benzyl 1-O-methyl (2S)-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].COC(=O)[C@@H](C(=O)OCc1ccccc1)n1cc[n+](C)c1 |
| InChI | InChI=1S/C15H17N2O4.C8H18O4S/c1-16-8-9-17(11-16)13(14(18)20-2)15(19)21-10-12-6-4-3-5-7-12;1-2-3-4-5-6-7-8-12-13(9,10)11/h3-9,11,13H,10H2,1-2H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1/t13-;/m0./s1 |
| InChIKey | BORKEBDKTBILKD-ZOWNYOTGSA-M |
| XLogP | 2.59 |
| TPSA | 127.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|