C27H42N2O8S — CID 87076293
3-O-benzyl 1-O-pentyl 2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate (PubChem CID 87076293) has the molecular formula C27H42N2O8S and a molecular weight of 554.71 g/mol. Its IUPAC name is 3-O-benzyl 1-O-pentyl 2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate.
| Compound Name | 3-O-benzyl 1-O-pentyl 2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
|---|---|
| PubChem CID | 87076293 |
| Molecular Formula | C27H42N2O8S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 3-O-benzyl 1-O-pentyl 2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCCCOC(=O)C(C(=O)OCc1ccccc1)n1cc[n+](C)c1 |
| InChI | InChI=1S/C19H25N2O4.C8H18O4S/c1-3-4-8-13-24-18(22)17(21-12-11-20(2)15-21)19(23)25-14-16-9-6-5-7-10-16;1-2-3-4-5-6-7-8-12-13(9,10)11/h5-7,9-12,15,17H,3-4,8,13-14H2,1-2H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | QHFODZSUCUSNTD-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 127.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|