About decyl sulfate;1-ethyl-3-methylimidazol-3-ium
decyl sulfate;1-ethyl-3-methylimidazol-3-ium (PubChem CID 162624405) has the molecular formula C16H32N2O4S
and a molecular weight of 348.51 g/mol. Its IUPAC name is decyl sulfate;1-ethyl-3-methylimidazol-3-ium.
Molecular Properties
| Compound Name | decyl sulfate;1-ethyl-3-methylimidazol-3-ium |
| PubChem CID | 162624405 |
| Molecular Formula | C16H32N2O4S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | decyl sulfate;1-ethyl-3-methylimidazol-3-ium |
| SMILES | CCCCCCCCCCOS(=O)(=O)[O-].CCn1cc[n+](C)c1 |
| InChI | InChI=1S/C10H22O4S.C6H11N2/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13;1-3-8-5-4-7(2)6-8/h2-10H2,1H3,(H,11,12,13);4-6H,3H2,1-2H3/q;+1/p-1 |
| InChIKey | OANWOQALULMNSB-UHFFFAOYSA-M |
| XLogP | 2.94 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze decyl sulfate;1-ethyl-3-methylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl sulfate;1-ethyl-3-methylimidazol-3-ium?
The IUPAC name of decyl sulfate;1-ethyl-3-methylimidazol-3-ium (CID 162624405) is decyl sulfate;1-ethyl-3-methylimidazol-3-ium.
What is the SMILES notation for decyl sulfate;1-ethyl-3-methylimidazol-3-ium?
The canonical SMILES for decyl sulfate;1-ethyl-3-methylimidazol-3-ium is CCCCCCCCCCOS(=O)(=O)[O-].CCn1cc[n+](C)c1.
What is the InChIKey of decyl sulfate;1-ethyl-3-methylimidazol-3-ium?
The InChIKey is OANWOQALULMNSB-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22O4S.C6H11N2/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13;1-3-8-5-4-7(2)6-8/h2-10H2,1H3,(H,11,12,13);4-6H,3H2,1-2H3/q;+1/p-1.
What are the key properties of decyl sulfate;1-ethyl-3-methylimidazol-3-ium?
decyl sulfate;1-ethyl-3-methylimidazol-3-ium has a molecular weight of 348.51 g/mol, XLogP of 2.94, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for decyl sulfate;1-ethyl-3-methylimidazol-3-ium is sourced from PubChem (CID 162624405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).