About calcium nonyl sulfate
calcium nonyl sulfate (PubChem CID 101286747) has the molecular formula C18H38CaO8S2
and a molecular weight of 486.71 g/mol. Its IUPAC name is calcium nonyl sulfate.
Molecular Properties
| Compound Name | calcium nonyl sulfate |
| PubChem CID | 101286747 |
| Molecular Formula | C18H38CaO8S2 |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | calcium nonyl sulfate |
| SMILES | CCCCCCCCCOS(=O)(=O)[O-].CCCCCCCCCOS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C9H20O4S.Ca/c2*1-2-3-4-5-6-7-8-9-13-14(10,11)12;/h2*2-9H2,1H3,(H,10,11,12);/q;;+2/p-2 |
| InChIKey | ZYVVSXTXFUWWAU-UHFFFAOYSA-L |
| XLogP | 4.05 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze calcium nonyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium nonyl sulfate?
The IUPAC name of calcium nonyl sulfate (CID 101286747) is calcium nonyl sulfate.
What is the SMILES notation for calcium nonyl sulfate?
The canonical SMILES for calcium nonyl sulfate is CCCCCCCCCOS(=O)(=O)[O-].CCCCCCCCCOS(=O)(=O)[O-].[Ca+2].
What is the InChIKey of calcium nonyl sulfate?
The InChIKey is ZYVVSXTXFUWWAU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H20O4S.Ca/c2*1-2-3-4-5-6-7-8-9-13-14(10,11)12;/h2*2-9H2,1H3,(H,10,11,12);/q;;+2/p-2.
What are the key properties of calcium nonyl sulfate?
calcium nonyl sulfate has a molecular weight of 486.71 g/mol, XLogP of 4.05, 18 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for calcium nonyl sulfate is sourced from PubChem (CID 101286747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).