About zinc octyl sulfate
zinc octyl sulfate (PubChem CID 139716471) has the molecular formula C16H34O8S2Zn
and a molecular weight of 483.96 g/mol. Its IUPAC name is zinc octyl sulfate.
Molecular Properties
| Compound Name | zinc octyl sulfate |
| PubChem CID | 139716471 |
| Molecular Formula | C16H34O8S2Zn |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | zinc octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCCCCCCOS(=O)(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C8H18O4S.Zn/c2*1-2-3-4-5-6-7-8-12-13(9,10)11;/h2*2-8H2,1H3,(H,9,10,11);/q;;+2/p-2 |
| InChIKey | OPWVEBOZVBVAPC-UHFFFAOYSA-L |
| XLogP | 3.64 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze zinc octyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc octyl sulfate?
The IUPAC name of zinc octyl sulfate (CID 139716471) is zinc octyl sulfate.
What is the SMILES notation for zinc octyl sulfate?
The canonical SMILES for zinc octyl sulfate is CCCCCCCCOS(=O)(=O)[O-].CCCCCCCCOS(=O)(=O)[O-].[Zn+2].
What is the InChIKey of zinc octyl sulfate?
The InChIKey is OPWVEBOZVBVAPC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H18O4S.Zn/c2*1-2-3-4-5-6-7-8-12-13(9,10)11;/h2*2-8H2,1H3,(H,9,10,11);/q;;+2/p-2.
What are the key properties of zinc octyl sulfate?
zinc octyl sulfate has a molecular weight of 483.96 g/mol, XLogP of 3.64, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc octyl sulfate is sourced from PubChem (CID 139716471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).