C12H24N2O4S — CID 87240921
1-butyl-3-methylimidazol-3-ium;butyl sulfate (PubChem CID 87240921) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;butyl sulfate.
| Compound Name | 1-butyl-3-methylimidazol-3-ium;butyl sulfate |
|---|---|
| PubChem CID | 87240921 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;butyl sulfate |
| SMILES | CCCCOS(=O)(=O)[O-].CCCCn1cc[n+](C)c1 |
| InChI | InChI=1S/C8H15N2.C4H10O4S/c1-3-4-5-10-7-6-9(2)8-10;1-2-3-4-8-9(5,6)7/h6-8H,3-5H2,1-2H3;2-4H2,1H3,(H,5,6,7)/q+1;/p-1 |
| InChIKey | GMZZZEIFBDVRMN-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|