C25H40N2O6S — CID 159748209
octyl sulfate;[(1R)-1-phenylpentyl] 2-(3-methylimidazol-3-ium-1-yl)acetate (PubChem CID 159748209) has the molecular formula C25H40N2O6S and a molecular weight of 496.67 g/mol. Its IUPAC name is octyl sulfate;[(1R)-1-phenylpentyl] 2-(3-methylimidazol-3-ium-1-yl)acetate.
| Compound Name | octyl sulfate;[(1R)-1-phenylpentyl] 2-(3-methylimidazol-3-ium-1-yl)acetate |
|---|---|
| PubChem CID | 159748209 |
| Molecular Formula | C25H40N2O6S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | octyl sulfate;[(1R)-1-phenylpentyl] 2-(3-methylimidazol-3-ium-1-yl)acetate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCC[C@@H](OC(=O)Cn1cc[n+](C)c1)c1ccccc1 |
| InChI | InChI=1S/C17H23N2O2.C8H18O4S/c1-3-4-10-16(15-8-6-5-7-9-15)21-17(20)13-19-12-11-18(2)14-19;1-2-3-4-5-6-7-8-12-13(9,10)11/h5-9,11-12,14,16H,3-4,10,13H2,1-2H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1/t16-;/m1./s1 |
| InChIKey | NDHXQJNFDNIZMN-PKLMIRHRSA-M |
| XLogP | 4.61 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|