C21H40N2O7S — CID 87367100
1-butoxyethyl 2-(2,3-dimethylimidazol-3-ium-1-yl)acetate;octyl sulfate (PubChem CID 87367100) has the molecular formula C21H40N2O7S and a molecular weight of 464.63 g/mol. Its IUPAC name is 1-butoxyethyl 2-(2,3-dimethylimidazol-3-ium-1-yl)acetate;octyl sulfate.
| Compound Name | 1-butoxyethyl 2-(2,3-dimethylimidazol-3-ium-1-yl)acetate;octyl sulfate |
|---|---|
| PubChem CID | 87367100 |
| Molecular Formula | C21H40N2O7S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 1-butoxyethyl 2-(2,3-dimethylimidazol-3-ium-1-yl)acetate;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCCOC(C)OC(=O)Cn1cc[n+](C)c1C |
| InChI | InChI=1S/C13H23N2O3.C8H18O4S/c1-5-6-9-17-12(3)18-13(16)10-15-8-7-14(4)11(15)2;1-2-3-4-5-6-7-8-12-13(9,10)11/h7-8,12H,5-6,9-10H2,1-4H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | GRFNBEQPBGBUCM-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 110.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|