C17H33BrN2 — CID 87228975
1-dodecyl-2,3-dimethylimidazol-3-ium bromide (PubChem CID 87228975) has the molecular formula C17H33BrN2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-dodecyl-2,3-dimethylimidazol-3-ium bromide.
| Compound Name | 1-dodecyl-2,3-dimethylimidazol-3-ium bromide |
|---|---|
| PubChem CID | 87228975 |
| Molecular Formula | C17H33BrN2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-dodecyl-2,3-dimethylimidazol-3-ium bromide |
| SMILES | CCCCCCCCCCCCn1cc[n+](C)c1C.[Br-] |
| InChI | InChI=1S/C17H33N2.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-19-16-15-18(3)17(19)2;/h15-16H,4-14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DTAQICDIDNVMJA-UHFFFAOYSA-M |
| XLogP | 1.55 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|