C9H19IN2+2 — CID 172822864
iodanium 1-butyl-2,3-dimethylimidazol-3-ium (PubChem CID 172822864) has the molecular formula C9H19IN2+2 and a molecular weight of 282.17 g/mol. Its IUPAC name is iodanium 1-butyl-2,3-dimethylimidazol-3-ium.
| Compound Name | iodanium 1-butyl-2,3-dimethylimidazol-3-ium |
|---|---|
| PubChem CID | 172822864 |
| Molecular Formula | C9H19IN2+2 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | iodanium 1-butyl-2,3-dimethylimidazol-3-ium |
| SMILES | CCCCn1cc[n+](C)c1C.[IH2+] |
| InChI | InChI=1S/C9H17N2.H2I/c1-4-5-6-11-8-7-10(3)9(11)2;/h7-8H,4-6H2,1-3H3;1H2/q2*+1 |
| InChIKey | WSCXURYVTUWYPW-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|