C15H30BBrF4N2 — CID 173037633
1-decyl-2,3-dimethylimidazol-3-ium;tetrafluoroborate;hydrobromide (PubChem CID 173037633) has the molecular formula C15H30BBrF4N2 and a molecular weight of 405.13 g/mol. Its IUPAC name is 1-decyl-2,3-dimethylimidazol-3-ium;tetrafluoroborate;hydrobromide.
| Compound Name | 1-decyl-2,3-dimethylimidazol-3-ium;tetrafluoroborate;hydrobromide |
|---|---|
| PubChem CID | 173037633 |
| Molecular Formula | C15H30BBrF4N2 |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-decyl-2,3-dimethylimidazol-3-ium;tetrafluoroborate;hydrobromide |
| SMILES | Br.CCCCCCCCCCn1cc[n+](C)c1C.F[B-](F)(F)F |
| InChI | InChI=1S/C15H29N2.BF4.BrH/c1-4-5-6-7-8-9-10-11-12-17-14-13-16(3)15(17)2;2-1(3,4)5;/h13-14H,4-12H2,1-3H3;;1H/q+1;-1; |
| InChIKey | MNUAPVAPVZHDFW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|