C10H18F3N2O3S+ — CID 159228243
1-butyl-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonic acid (PubChem CID 159228243) has the molecular formula C10H18F3N2O3S+ and a molecular weight of 303.33 g/mol. Its IUPAC name is 1-butyl-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonic acid.
| Compound Name | 1-butyl-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 159228243 |
| Molecular Formula | C10H18F3N2O3S+ |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-butyl-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonic acid |
| SMILES | CCCCn1cc[n+](C)c1C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H17N2.CHF3O3S/c1-4-5-6-11-8-7-10(3)9(11)2;2-1(3,4)8(5,6)7/h7-8H,4-6H2,1-3H3;(H,5,6,7)/q+1; |
| InChIKey | KSOGGGZFEJTGPZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|