C11H15F6N2O4S+ — CID 91297712
2-(1-butyl-3-methylimidazol-3-ium-2-yl)-1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonic acid (PubChem CID 91297712) has the molecular formula C11H15F6N2O4S+ and a molecular weight of 385.31 g/mol. Its IUPAC name is 2-(1-butyl-3-methylimidazol-3-ium-2-yl)-1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonic acid.
| Compound Name | 2-(1-butyl-3-methylimidazol-3-ium-2-yl)-1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 91297712 |
| Molecular Formula | C11H15F6N2O4S+ |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-(1-butyl-3-methylimidazol-3-ium-2-yl)-1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonic acid |
| SMILES | CCCCn1cc[n+](C)c1C(F)(OC(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H14F6N2O4S/c1-3-4-5-19-7-6-18(2)8(19)9(12,23-11(15,16)17)10(13,14)24(20,21)22/h6-7H,3-5H2,1-2H3/p+1 |
| InChIKey | JUSWZSCBOSPNMK-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|