C14H22F6N3O4S2+ — CID 87204722
1,1,1-trifluoro-N-(1-methyl-3-octylimidazol-1-ium-2-yl)-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 87204722) has the molecular formula C14H22F6N3O4S2+ and a molecular weight of 474.47 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(1-methyl-3-octylimidazol-1-ium-2-yl)-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(1-methyl-3-octylimidazol-1-ium-2-yl)-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 87204722 |
| Molecular Formula | C14H22F6N3O4S2+ |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 1,1,1-trifluoro-N-(1-methyl-3-octylimidazol-1-ium-2-yl)-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCCCCCn1cc[n+](C)c1N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H22F6N3O4S2/c1-3-4-5-6-7-8-9-22-11-10-21(2)12(22)23(28(24,25)13(15,16)17)29(26,27)14(18,19)20/h10-11H,3-9H2,1-2H3/q+1 |
| InChIKey | OHQXBXWRFTUHEM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|