C20H28F12N6O8S4 — CID 11331894
bis(bis(trifluoromethylsulfonyl)azanide);1-butyl-2-(1-butyl-3-methylimidazol-3-ium-2-yl)-3-methylimidazol-3-ium (PubChem CID 11331894) has the molecular formula C20H28F12N6O8S4 and a molecular weight of 836.72 g/mol. Its IUPAC name is bis(bis(trifluoromethylsulfonyl)azanide);1-butyl-2-(1-butyl-3-methylimidazol-3-ium-2-yl)-3-methylimidazol-3-ium.
| Compound Name | bis(bis(trifluoromethylsulfonyl)azanide);1-butyl-2-(1-butyl-3-methylimidazol-3-ium-2-yl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 11331894 |
| Molecular Formula | C20H28F12N6O8S4 |
| Molecular Weight | 836.72 g/mol |
| Exact Mass | 836.07 |
| IUPAC Name | bis(bis(trifluoromethylsulfonyl)azanide);1-butyl-2-(1-butyl-3-methylimidazol-3-ium-2-yl)-3-methylimidazol-3-ium |
| SMILES | CCCCn1cc[n+](C)c1-c1n(CCCC)cc[n+]1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H28N4.2C2F6NO4S2/c1-5-7-9-19-13-11-17(3)15(19)16-18(4)12-14-20(16)10-8-6-2;2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h11-14H,5-10H2,1-4H3;;/q+2;2*-1 |
| InChIKey | AMNPWOSVULTSEA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 182.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|