C17H30F6N4O5S2 — CID 11649667
bis(trifluoromethylsulfonyl)azanide;(2S)-2-[(1-butyl-3-methylimidazol-3-ium-2-yl)methylamino]-3,3-dimethylbutan-1-ol (PubChem CID 11649667) has the molecular formula C17H30F6N4O5S2 and a molecular weight of 548.57 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;(2S)-2-[(1-butyl-3-methylimidazol-3-ium-2-yl)methylamino]-3,3-dimethylbutan-1-ol.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;(2S)-2-[(1-butyl-3-methylimidazol-3-ium-2-yl)methylamino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 11649667 |
| Molecular Formula | C17H30F6N4O5S2 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;(2S)-2-[(1-butyl-3-methylimidazol-3-ium-2-yl)methylamino]-3,3-dimethylbutan-1-ol |
| SMILES | CCCCn1cc[n+](C)c1CN[C@H](CO)C(C)(C)C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H30N3O.C2F6NO4S2/c1-6-7-8-18-10-9-17(5)14(18)11-16-13(12-19)15(2,3)4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h9-10,13,16,19H,6-8,11-12H2,1-5H3;/q+1;-1/t13-;/m1./s1 |
| InChIKey | BNORTALAXLBPTE-BTQNPOSSSA-N |
| XLogP | 2.67 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|