C16H23F6N5O4S2 — CID 11541004
bis(trifluoromethylsulfonyl)azanide;1-hexyl-2-methyl-3-(pyrazol-1-ylmethyl)imidazol-3-ium (PubChem CID 11541004) has the molecular formula C16H23F6N5O4S2 and a molecular weight of 527.51 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-hexyl-2-methyl-3-(pyrazol-1-ylmethyl)imidazol-3-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-hexyl-2-methyl-3-(pyrazol-1-ylmethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 11541004 |
| Molecular Formula | C16H23F6N5O4S2 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-hexyl-2-methyl-3-(pyrazol-1-ylmethyl)imidazol-3-ium |
| SMILES | CCCCCCn1cc[n+](Cn2cccn2)c1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H23N4.C2F6NO4S2/c1-3-4-5-6-9-16-11-12-17(14(16)2)13-18-10-7-8-15-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-8,10-12H,3-6,9,13H2,1-2H3;/q+1;-1 |
| InChIKey | GZJPOIAKYMIYCS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|