C14H16F12N6O8S4 — CID 11297190
bis(bis(trifluoromethylsulfonyl)azanide);2-(1,3-dimethylimidazol-1-ium-2-yl)-1,3-dimethylimidazol-1-ium (PubChem CID 11297190) has the molecular formula C14H16F12N6O8S4 and a molecular weight of 752.56 g/mol. Its IUPAC name is bis(bis(trifluoromethylsulfonyl)azanide);2-(1,3-dimethylimidazol-1-ium-2-yl)-1,3-dimethylimidazol-1-ium.
| Compound Name | bis(bis(trifluoromethylsulfonyl)azanide);2-(1,3-dimethylimidazol-1-ium-2-yl)-1,3-dimethylimidazol-1-ium |
|---|---|
| PubChem CID | 11297190 |
| Molecular Formula | C14H16F12N6O8S4 |
| Molecular Weight | 752.56 g/mol |
| Exact Mass | 751.97 |
| IUPAC Name | bis(bis(trifluoromethylsulfonyl)azanide);2-(1,3-dimethylimidazol-1-ium-2-yl)-1,3-dimethylimidazol-1-ium |
| SMILES | Cn1cc[n+](C)c1-c1n(C)cc[n+]1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16N4.2C2F6NO4S2/c1-11-5-6-12(2)9(11)10-13(3)7-8-14(10)4;2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-8H,1-4H3;;/q+2;2*-1 |
| InChIKey | UNAUBKBRZLUGMA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 182.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|