C11H18F6N3O4S2+ — CID 123134715
1-butyl-2,3-dimethylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 123134715) has the molecular formula C11H18F6N3O4S2+ and a molecular weight of 434.40 g/mol. Its IUPAC name is 1-butyl-2,3-dimethylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1-butyl-2,3-dimethylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 123134715 |
| Molecular Formula | C11H18F6N3O4S2+ |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 1-butyl-2,3-dimethylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCn1cc[n+](C)c1C.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H17N2.C2HF6NO4S2/c1-4-5-6-11-8-7-10(3)9(11)2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-8H,4-6H2,1-3H3;9H/q+1; |
| InChIKey | SEWZDTBJTLBSFY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|