C11H18N4O2 — CID 173015373
1-butyl-2,3-dimethylimidazol-3-ium;cyanic acid;isocyanate (PubChem CID 173015373) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-butyl-2,3-dimethylimidazol-3-ium;cyanic acid;isocyanate.
| Compound Name | 1-butyl-2,3-dimethylimidazol-3-ium;cyanic acid;isocyanate |
|---|---|
| PubChem CID | 173015373 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-butyl-2,3-dimethylimidazol-3-ium;cyanic acid;isocyanate |
| SMILES | CCCCn1cc[n+](C)c1C.N#CO.[N-]=C=O |
| InChI | InChI=1S/C9H17N2.CHNO.CNO/c1-4-5-6-11-8-7-10(3)9(11)2;2*2-1-3/h7-8H,4-6H2,1-3H3;3H;/q+1;;-1 |
| InChIKey | XZTNMARTRKPNTL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|