C16H22N2O2 — CID 87436248
1-butyl-2,3-dimethylimidazol-3-ium benzoate (PubChem CID 87436248) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-butyl-2,3-dimethylimidazol-3-ium benzoate.
| Compound Name | 1-butyl-2,3-dimethylimidazol-3-ium benzoate |
|---|---|
| PubChem CID | 87436248 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-butyl-2,3-dimethylimidazol-3-ium benzoate |
| SMILES | CCCCn1cc[n+](C)c1C.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C9H17N2.C7H6O2/c1-4-5-6-11-8-7-10(3)9(11)2;8-7(9)6-4-2-1-3-5-6/h7-8H,4-6H2,1-3H3;1-5H,(H,8,9)/q+1;/p-1 |
| InChIKey | BWIPSFVXKDVFKI-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|