C20H38N4+2 — CID 162092201
1-butyl-2,3-dimethylimidazol-3-ium;1,3-dibutylimidazol-1-ium (PubChem CID 162092201) has the molecular formula C20H38N4+2 and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-butyl-2,3-dimethylimidazol-3-ium;1,3-dibutylimidazol-1-ium.
| Compound Name | 1-butyl-2,3-dimethylimidazol-3-ium;1,3-dibutylimidazol-1-ium |
|---|---|
| PubChem CID | 162092201 |
| Molecular Formula | C20H38N4+2 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | 1-butyl-2,3-dimethylimidazol-3-ium;1,3-dibutylimidazol-1-ium |
| SMILES | CCCCn1cc[n+](C)c1C.CCCCn1cc[n+](CCCC)c1 |
| InChI | InChI=1S/C11H21N2.C9H17N2/c1-3-5-7-12-9-10-13(11-12)8-6-4-2;1-4-5-6-11-8-7-10(3)9(11)2/h9-11H,3-8H2,1-2H3;7-8H,4-6H2,1-3H3/q2*+1 |
| InChIKey | ZDTOULNBHYOSJY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|