C18H30N6S2 — CID 159228828
1-butyl-3-ethylimidazol-1-ium;1-ethyl-2,3-dimethylimidazol-3-ium;diisothiocyanate (PubChem CID 159228828) has the molecular formula C18H30N6S2 and a molecular weight of 394.61 g/mol. Its IUPAC name is 1-butyl-3-ethylimidazol-1-ium;1-ethyl-2,3-dimethylimidazol-3-ium;diisothiocyanate.
| Compound Name | 1-butyl-3-ethylimidazol-1-ium;1-ethyl-2,3-dimethylimidazol-3-ium;diisothiocyanate |
|---|---|
| PubChem CID | 159228828 |
| Molecular Formula | C18H30N6S2 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-butyl-3-ethylimidazol-1-ium;1-ethyl-2,3-dimethylimidazol-3-ium;diisothiocyanate |
| SMILES | CCCC[n+]1ccn(CC)c1.CCn1cc[n+](C)c1C.[N-]=C=S.[N-]=C=S |
| InChI | InChI=1S/C9H17N2.C7H13N2.2CNS/c1-3-5-6-11-8-7-10(4-2)9-11;1-4-9-6-5-8(3)7(9)2;2*2-1-3/h7-9H,3-6H2,1-2H3;5-6H,4H2,1-3H3;;/q2*+1;2*-1 |
| InChIKey | SWKKFKPKDSAFAQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|