C7H13F6N2Sb — CID 160599976
1-ethyl-2,3-dimethylimidazol-3-ium;hexafluoroantimony(1-) (PubChem CID 160599976) has the molecular formula C7H13F6N2Sb and a molecular weight of 360.94 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylimidazol-3-ium;hexafluoroantimony(1-).
| Compound Name | 1-ethyl-2,3-dimethylimidazol-3-ium;hexafluoroantimony(1-) |
|---|---|
| PubChem CID | 160599976 |
| Molecular Formula | C7H13F6N2Sb |
| Molecular Weight | 360.94 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 1-ethyl-2,3-dimethylimidazol-3-ium;hexafluoroantimony(1-) |
| SMILES | CCn1cc[n+](C)c1C.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C7H13N2.6FH.Sb/c1-4-9-6-5-8(3)7(9)2;;;;;;;/h5-6H,4H2,1-3H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | REDIGQAUYHDIDB-UHFFFAOYSA-H |
| XLogP | 2.78 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.94 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|