C9H13BF8N2 — CID 141212969
1-ethyl-2,3-dimethylimidazol-3-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide (PubChem CID 141212969) has the molecular formula C9H13BF8N2 and a molecular weight of 312.01 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylimidazol-3-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide.
| Compound Name | 1-ethyl-2,3-dimethylimidazol-3-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
|---|---|
| PubChem CID | 141212969 |
| Molecular Formula | C9H13BF8N2 |
| Molecular Weight | 312.01 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-ethyl-2,3-dimethylimidazol-3-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
| SMILES | CCn1cc[n+](C)c1C.F[B-](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H13N2.C2BF8/c1-4-9-6-5-8(3)7(9)2;4-1(5,2(6,7)8)3(9,10)11/h5-6H,4H2,1-3H3;/q+1;-1 |
| InChIKey | IIIFURHIUNDKQB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.01 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|