C9H15BF4N2 — CID 134716206
1-but-2-enyl-2,3-dimethylimidazol-3-ium tetrafluoroborate (PubChem CID 134716206) has the molecular formula C9H15BF4N2 and a molecular weight of 238.04 g/mol. Its IUPAC name is 1-but-2-enyl-2,3-dimethylimidazol-3-ium tetrafluoroborate.
| Compound Name | 1-but-2-enyl-2,3-dimethylimidazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 134716206 |
| Molecular Formula | C9H15BF4N2 |
| Molecular Weight | 238.04 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-but-2-enyl-2,3-dimethylimidazol-3-ium tetrafluoroborate |
| SMILES | CC=CCn1cc[n+](C)c1C.F[B-](F)(F)F |
| InChI | InChI=1S/C9H15N2.BF4/c1-4-5-6-11-8-7-10(3)9(11)2;2-1(3,4)5/h4-5,7-8H,6H2,1-3H3;/q+1;-1 |
| InChIKey | QCMKWMDOUOCZJX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.04 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|