C7H11N2O+ — CID 87431121
2-(2,3-dimethylimidazol-3-ium-1-yl)acetaldehyde (PubChem CID 87431121) has the molecular formula C7H11N2O+ and a molecular weight of 139.18 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-3-ium-1-yl)acetaldehyde.
| Compound Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 87431121 |
| Molecular Formula | C7H11N2O+ |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)acetaldehyde |
| SMILES | Cc1n(CC=O)cc[n+]1C |
| InChI | InChI=1S/C7H11N2O/c1-7-8(2)3-4-9(7)5-6-10/h3-4,6H,5H2,1-2H3/q+1 |
| InChIKey | QZXKCXFQHUZULN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|