C7H14N2O5S — CID 141483364
2-(2,3-dimethylimidazol-3-ium-1-yl)ethanol;hydrogen sulfate (PubChem CID 141483364) has the molecular formula C7H14N2O5S and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-3-ium-1-yl)ethanol;hydrogen sulfate.
| Compound Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)ethanol;hydrogen sulfate |
|---|---|
| PubChem CID | 141483364 |
| Molecular Formula | C7H14N2O5S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)ethanol;hydrogen sulfate |
| SMILES | Cc1n(CCO)cc[n+]1C.O=S(=O)([O-])O |
| InChI | InChI=1S/C7H13N2O.H2O4S/c1-7-8(2)3-4-9(7)5-6-10;1-5(2,3)4/h3-4,10H,5-6H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | XANGOLFPSPCUSZ-UHFFFAOYSA-M |
| XLogP | -1.38 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|