C10H13F6N2O4S+ — CID 102418050
1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethoxy]-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid (PubChem CID 102418050) has the molecular formula C10H13F6N2O4S+ and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethoxy]-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid.
| Compound Name | 1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethoxy]-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 102418050 |
| Molecular Formula | C10H13F6N2O4S+ |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethoxy]-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid |
| SMILES | Cc1n(CCOC(F)(F)C(F)(C(F)(F)F)S(=O)(=O)O)cc[n+]1C |
| InChI | InChI=1S/C10H12F6N2O4S/c1-7-17(2)3-4-18(7)5-6-22-10(15,16)8(11,9(12,13)14)23(19,20)21/h3-4H,5-6H2,1-2H3/p+1 |
| InChIKey | OIKNMTHLVZNVLA-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|